ChemNet > CAS > 110-41-8 2-Methylundecanal
110-41-8 2-Methylundecanal
| product Name |
2-Methylundecanal |
| CAS No |
110-41-8 |
| Molecular Formula |
C12H22O |
| Molecular Weight |
182.3025 |
| InChI |
InChI=1/C12H22O/c1-3-4-5-6-7-8-9-10-12(2)11-13/h10-11H,3-9H2,1-2H3 |
| EINECS |
203-765-0 |
| Molecular Structure |
|
| Density |
0.838g/cm3 |
| Boiling point |
262.7°C at 760 mmHg |
| Refractive index |
1.443 |
| Flash point |
81.4°C |
| Vapour Pressur |
0.0107mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
