ChemNet > CAS > 110127-07-6 2,6-Dibromo-4-nitrotoluene
110127-07-6 2,6-Dibromo-4-nitrotoluene
| product Name |
2,6-Dibromo-4-nitrotoluene |
| CAS No |
110127-07-6 |
| Synonyms |
1,3-dibromo-2-methyl-5-nitrobenzene |
| Molecular Formula |
C7H5Br2NO2 |
| Molecular Weight |
294.9281 |
| InChI |
InChI=1/C7H5Br2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
| Molecular Structure |
|
| Density |
1.967g/cm3 |
| Boiling point |
320.4°C at 760 mmHg |
| Refractive index |
1.625 |
| Flash point |
147.6°C |
| Vapour Pressur |
0.000598mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
