ChemNet > CAS > 111-21-7 Triethyleneglycoldiacetate
111-21-7 Triethyleneglycoldiacetate
| product Name |
Triethyleneglycoldiacetate |
| CAS No |
111-21-7 |
| Synonyms |
Triethylene glycol diacetate; ethane-1,2-diylbis(oxyethane-2,1-diyl) diacetate |
| Molecular Formula |
C10H18O6 |
| Molecular Weight |
234.2463 |
| InChI |
InChI=1/C10H18O6/c1-9(11)15-7-5-13-3-4-14-6-8-16-10(2)12/h3-8H2,1-2H3 |
| EINECS |
203-846-0 |
| Molecular Structure |
|
| Density |
1.098g/cm3 |
| Boiling point |
286°C at 760 mmHg |
| Refractive index |
1.432 |
| Flash point |
125.2°C |
| Vapour Pressur |
0.00271mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
