1113-63-9 2-Methylmalonodiamide
product Name |
2-Methylmalonodiamide |
CAS No |
1113-63-9 |
Synonyms |
2-Methylpropanediamide; 2-Methylmalonamide |
Molecular Formula |
C4H8N2O2 |
Molecular Weight |
116.1185 |
InChI |
InChI=1/C4H8N2O2/c1-2(3(5)7)4(6)8/h2H,1H3,(H2,5,7)(H2,6,8) |
Molecular Structure |
|
Density |
1.202g/cm3 |
Boiling point |
400.3°C at 760 mmHg |
Refractive index |
1.485 |
Flash point |
195.9°C |
Vapour Pressur |
1.28E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|