ChemNet > CAS > 1117-31-3 1,3-butanediol diacetate
1117-31-3 1,3-butanediol diacetate
| product Name |
1,3-butanediol diacetate |
| CAS No |
1117-31-3 |
| Synonyms |
1,3-butylene diacetate; 1,3-Butylene glycol diacetate; butane-1,3-diyl diacetate; 1,3-BGDA; 1,3-Diacetoxybutane |
| Molecular Formula |
C8H14O4 |
| Molecular Weight |
174.1944 |
| InChI |
InChI=1/C8H14O4/c1-6(12-8(3)10)4-5-11-7(2)9/h6H,4-5H2,1-3H3 |
| EINECS |
214-244-2 |
| Molecular Structure |
|
| Density |
1.037g/cm3 |
| Boiling point |
228.8°C at 760 mmHg |
| Refractive index |
1.421 |
| Flash point |
102.6°C |
| Vapour Pressur |
0.0722mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
