ChemNet > CAS > 111787-91-8 (2-methyl-5-phenyl-3-furyl)methanol
111787-91-8 (2-methyl-5-phenyl-3-furyl)methanol
| product Name |
(2-methyl-5-phenyl-3-furyl)methanol |
| CAS No |
111787-91-8 |
| Synonyms |
(2-methyl-5-phenylfuran-3-yl)methanol |
| Molecular Formula |
C12H12O2 |
| Molecular Weight |
188.2225 |
| InChI |
InChI=1/C12H12O2/c1-9-11(8-13)7-12(14-9)10-5-3-2-4-6-10/h2-7,13H,8H2,1H3 |
| Molecular Structure |
|
| Density |
1.123g/cm3 |
| Melting point |
22℃ |
| Boiling point |
233.9°C at 760 mmHg |
| Refractive index |
1.562 |
| Flash point |
95.2°C |
| Vapour Pressur |
0.0302mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
