ChemNet > CAS > 111821-49-9 4-Borono-D-phenylalanine
111821-49-9 4-Borono-D-phenylalanine
| product Name |
4-Borono-D-phenylalanine |
| CAS No |
111821-49-9 |
| Synonyms |
4-(dihydroxyboranyl)-D-phenylalanine |
| Molecular Formula |
C9H12BNO4 |
| Molecular Weight |
209.0069 |
| InChI |
InChI=1/C9H12BNO4/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4,8,14-15H,5,11H2,(H,12,13)/t8-/m1/s1 |
| Molecular Structure |
|
| Density |
1.34g/cm3 |
| Boiling point |
449.3°C at 760 mmHg |
| Refractive index |
1.59 |
| Flash point |
225.5°C |
| Vapour Pressur |
7.39E-09mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
