ChemNet > CAS > 1119-60-4 6-heptenoic acid
1119-60-4 6-heptenoic acid
| product Name |
6-heptenoic acid |
| Synonyms |
Hept-6-enoic acid |
| Molecular Formula |
C7H12O2 |
| Molecular Weight |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-2-3-4-5-6-7(8)9/h2H,1,3-6H2,(H,8,9) |
| CAS Registry Number |
1119-60-4 |
| EINECS |
214-283-5 |
| Molecular Structure |
|
| Density |
0.957g/cm3 |
| Boiling point |
226°C at 760 mmHg |
| Refractive index |
1.447 |
| Flash point |
113.3°C |
| Vapour Pressur |
0.0305mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
