ChemNet > CAS > 112-61-8 Methyl stearate
112-61-8 Methyl stearate
| product Name |
Methyl stearate |
| CAS No |
112-61-8 |
| Synonyms |
Methyl n-octadecanoate; Stearic acid methyl ester; methyl octadecanoate; Me-ST |
| Molecular Formula |
C19H38O2 |
| Molecular Weight |
298.5038 |
| InChI |
InChI=1/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
| EINECS |
203-990-4 |
| Molecular Structure |
|
| Density |
0.863g/cm3 |
| Melting point |
37-39℃ |
| Boiling point |
355.5°C at 760 mmHg |
| Refractive index |
1.444 |
| Flash point |
169.3°C |
| Vapour Pressur |
3.11E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
