112-79-8 Elaidic acid
product Name |
Elaidic acid |
CAS No |
112-79-8 |
Synonyms |
trans-9-Octadecenoic acid~trans-Oleic acid; trans-9-Octadecenic acid; (9E)-octadec-9-enoic acid |
Molecular Formula |
C18H34O2 |
Molecular Weight |
282.4614 |
InChI |
InChI=1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+ |
EINECS |
204-006-6 |
Molecular Structure |
|
Density |
0.899g/cm3 |
Melting point |
43-45℃ |
Boiling point |
360°C at 760 mmHg |
Refractive index |
1.466 |
Flash point |
270.1°C |
Vapour Pressur |
3.7E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|