ChemNet > CAS > 1122-97-0 4-(Methylthio)thiophenol
1122-97-0 4-(Methylthio)thiophenol
| product Name |
4-(Methylthio)thiophenol |
| CAS No |
1122-97-0 |
| Synonyms |
4-(Methylmercapto)thiophenol~4-(Methylthio)benzenethiol; 4-Mehyl Ithio Thiophenol; 4-(methylsulfanyl)benzenethiol |
| Molecular Formula |
C7H8S2 |
| Molecular Weight |
156.2684 |
| InChI |
InChI=1/C7H8S2/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3 |
| Molecular Structure |
|
| Density |
1.16g/cm3 |
| Boiling point |
252.9°C at 760 mmHg |
| Refractive index |
1.621 |
| Flash point |
106.7°C |
| Vapour Pressur |
0.03mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
