ChemNet > CAS > 1123-00-8 Cyclopentylacetic acid
1123-00-8 Cyclopentylacetic acid
| product Name |
Cyclopentylacetic acid |
| Synonyms |
Cyclopentaneacetic acid; cycylopentylacetic acid; cyclopentylacetate |
| Molecular Formula |
C7H11O2 |
| Molecular Weight |
127.1616 |
| InChI |
InChI=1/C7H12O2/c8-7(9)5-6-3-1-2-4-6/h6H,1-5H2,(H,8,9)/p-1 |
| CAS Registry Number |
1123-00-8 |
| EINECS |
214-368-7 |
| Molecular Structure |
|
| Boiling point |
230.2°C at 760 mmHg |
| Flash point |
114°C |
| Vapour Pressur |
0.0237mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Cyclopentylacetic acid Material Safety Data Sheet
|
|
