ChemNet > CAS > 1123-25-7 1-Methyl-1-cyclohexanecarboxylic acid
1123-25-7 1-Methyl-1-cyclohexanecarboxylic acid
| product Name |
1-Methyl-1-cyclohexanecarboxylic acid |
| CAS No |
1123-25-7 |
| Synonyms |
1-Methylcyclohexanecarboxylic acid; 1-Methyl-1-cyclohexancarboxylic acid; 1-methylcyclohexanecarboxylate |
| Molecular Formula |
C8H13O2 |
| Molecular Weight |
141.1882 |
| InChI |
InChI=1/C8H14O2/c1-8(7(9)10)5-3-2-4-6-8/h2-6H2,1H3,(H,9,10)/p-1 |
| EINECS |
214-371-3 |
| Molecular Structure |
|
| Melting point |
35-38℃ |
| Boiling point |
234°C at 760 mmHg |
| Flash point |
114°C |
| Vapour Pressur |
0.0188mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
