ChemNet > CAS > 1124-04-5 2-chloro-4,5-dimethylphenol
1124-04-5 2-chloro-4,5-dimethylphenol
| product Name |
2-chloro-4,5-dimethylphenol |
| CAS No |
1124-04-5 |
| Synonyms |
6-Chloro-3,4-xylenol (OH=1); 6-Chloro-3,4-xylenol |
| Molecular Formula |
C8H9ClO |
| Molecular Weight |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c1-5-3-7(9)8(10)4-6(5)2/h3-4,10H,1-2H3 |
| EINECS |
214-386-5 |
| Molecular Structure |
|
| Density |
1.183g/cm3 |
| Melting point |
70-72℃ |
| Boiling point |
237°C at 760 mmHg |
| Refractive index |
1.558 |
| Flash point |
97.1°C |
| Vapour Pressur |
0.03mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
