ChemNet > CAS > 113053-50-2 Methyl 1,2,3-benzotriazole-5-carboxylate
113053-50-2 Methyl 1,2,3-benzotriazole-5-carboxylate
| product Name |
Methyl 1,2,3-benzotriazole-5-carboxylate |
| CAS No |
113053-50-2 |
| Synonyms |
Methyl 1H-1,2,3-benzotriazole-5-carboxylate; methyl 2H-benzotriazole-5-carboxylate |
| Molecular Formula |
C8H7N3O2 |
| Molecular Weight |
177.1601 |
| InChI |
InChI=1/C8H7N3O2/c1-13-8(12)5-2-3-6-7(4-5)10-11-9-6/h2-4H,1H3,(H,9,10,11) |
| Molecular Structure |
|
| Density |
1.403g/cm3 |
| Melting point |
169-179℃ |
| Boiling point |
349.3°C at 760 mmHg |
| Refractive index |
1.658 |
| Flash point |
165.1°C |
| Vapour Pressur |
4.74E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
