ChemNet > CAS > 1133-77-3 1-phenyl-1H-pyrazole-5-carboxylic acid
1133-77-3 1-phenyl-1H-pyrazole-5-carboxylic acid
| product Name |
1-phenyl-1H-pyrazole-5-carboxylic acid |
| CAS No |
1133-77-3 |
| Molecular Formula |
C10H8N2O2 |
| Molecular Weight |
188.1827 |
| InChI |
InChI=1/C10H8N2O2/c13-10(14)9-6-7-11-12(9)8-4-2-1-3-5-8/h1-7H,(H,13,14) |
| Molecular Structure |
|
| Density |
1.28g/cm3 |
| Melting point |
183℃ |
| Boiling point |
379.6°C at 760 mmHg |
| Refractive index |
1.631 |
| Flash point |
183.4°C |
| Vapour Pressur |
1.93E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
