ChemNet > CAS > 1135-12-2 4-Aminodiphenylmethane
1135-12-2 4-Aminodiphenylmethane
| product Name |
4-Aminodiphenylmethane |
| CAS No |
1135-12-2 |
| Synonyms |
4-Benzylaniline; 1,1,2,2-tetramethyl-3,4-di(propan-2-ylidene)cyclobutane |
| Molecular Formula |
C13H13N |
| Molecular Weight |
183.249 |
| InChI |
InChI=1/C13H13N/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10,14H2 |
| Molecular Structure |
|
| Density |
1.07g/cm3 |
| Boiling point |
300°C at 760 mmHg |
| Refractive index |
1.616 |
| Flash point |
159.5°C |
| Vapour Pressur |
0.00115mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
