ChemNet > CAS > 113826-87-2 (3-methyl-5-phenyl-4-isoxazolyl)methanol
113826-87-2 (3-methyl-5-phenyl-4-isoxazolyl)methanol
| product Name |
(3-methyl-5-phenyl-4-isoxazolyl)methanol |
| CAS No |
113826-87-2 |
| Synonyms |
(3-methyl-5-phenylisoxazol-4-yl)methanol |
| Molecular Formula |
C11H11NO2 |
| Molecular Weight |
189.2105 |
| InChI |
InChI=1/C11H11NO2/c1-8-10(7-13)11(14-12-8)9-5-3-2-4-6-9/h2-6,13H,7H2,1H3 |
| Molecular Structure |
|
| Density |
1.176g/cm3 |
| Melting point |
110℃ |
| Boiling point |
379.4°C at 760 mmHg |
| Refractive index |
1.566 |
| Flash point |
183.2°C |
| Vapour Pressur |
1.97E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
