ChemNet > CAS > 1141-23-7 3-(4-Chlorophenyl)glutaramic acid
1141-23-7 3-(4-Chlorophenyl)glutaramic acid
| product Name |
3-(4-Chlorophenyl)glutaramic acid |
| CAS No |
1141-23-7 |
| Synonyms |
3-(4-Chloro phenyl) Glutaric acid monoamide; 5-amino-3-(4-chlorophenyl)-5-oxopentanoic acid; β-(4-chlorophenyl)Glutarimide |
| Molecular Formula |
C11H12ClNO3 |
| Molecular Weight |
241.6709 |
| InChI |
InChI=1/C11H12ClNO3/c12-9-3-1-7(2-4-9)8(5-10(13)14)6-11(15)16/h1-4,8H,5-6H2,(H2,13,14)(H,15,16) |
| Molecular Structure |
|
| Density |
1.343g/cm3 |
| Boiling point |
494.9°C at 760 mmHg |
| Refractive index |
1.578 |
| Flash point |
253.1°C |
| Vapour Pressur |
1.3E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
