ChemNet > CAS > 114636-31-6 (3S)-(-)-3-Acetamidopyrrolidine
114636-31-6 (3S)-(-)-3-Acetamidopyrrolidine
| product Name |
(3S)-(-)-3-Acetamidopyrrolidine |
| CAS No |
114636-31-6 |
| Synonyms |
N-[(3R)-pyrrolidin-3-yl]acetamide; N-[(3S)-pyrrolidin-3-yl]acetamide |
| Molecular Formula |
C6H12N2O |
| Molecular Weight |
128.1723 |
| InChI |
InChI=1/C6H12N2O/c1-5(9)8-6-2-3-7-4-6/h6-7H,2-4H2,1H3,(H,8,9)/t6-/m0/s1 |
| Molecular Structure |
|
| Density |
1.04g/cm3 |
| Boiling point |
306.8°C at 760 mmHg |
| Refractive index |
1.485 |
| Flash point |
150.8°C |
| Vapour Pressur |
0.000752mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
