ChemNet > CAS > 114686-85-0 2,3-Dichlorophenethylalcohol
114686-85-0 2,3-Dichlorophenethylalcohol
| product Name |
2,3-Dichlorophenethylalcohol |
| CAS No |
114686-85-0 |
| Synonyms |
2-(2,3-dichlorophenyl)ethanol |
| Molecular Formula |
C8H8Cl2O |
| Molecular Weight |
191.0545 |
| InChI |
InChI=1/C8H8Cl2O/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3,11H,4-5H2 |
| Molecular Structure |
|
| Density |
1.329g/cm3 |
| Boiling point |
279.1°C at 760 mmHg |
| Refractive index |
1.569 |
| Flash point |
117.9°C |
| Vapour Pressur |
0.00196mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
