ChemNet > CAS > 1147-65-5 (2-Carboxyphenyl)iminodiacetic acid
1147-65-5 (2-Carboxyphenyl)iminodiacetic acid
| product Name |
(2-Carboxyphenyl)iminodiacetic acid |
| CAS No |
1147-65-5 |
| Synonyms |
N,N-Bis(carboxymethyl)anthranilic acid; 2-[bis(carboxymethyl)amino]benzoic acid |
| Molecular Formula |
C11H11NO6 |
| Molecular Weight |
253.2081 |
| InChI |
InChI=1/C11H11NO6/c13-9(14)5-12(6-10(15)16)8-4-2-1-3-7(8)11(17)18/h1-4H,5-6H2,(H,13,14)(H,15,16)(H,17,18) |
| Molecular Structure |
|
| Density |
1.56g/cm3 |
| Boiling point |
560.9°C at 760 mmHg |
| Refractive index |
1.66 |
| Flash point |
293°C |
| Vapour Pressur |
2.04E-13mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
