ChemNet > CAS > 1152-62-1 Z-L-methionine
1152-62-1 Z-L-methionine
| product Name |
Z-L-methionine |
| CAS No |
1152-62-1 |
| Synonyms |
N-carbobenzyloxy-L-methionine; N-cbz-L-methionine; Z-Met-OH; N-Carbobenzoxy-L-methionine; CBZ-L-Methionine-OH; N-Benzyloxycarbonyl-L-methionine; N-[(benzyloxy)carbonyl]methionine; N-[(benzyloxy)carbonyl]-L-methionine; Cbz-L-methionine |
| Molecular Formula |
C13H17NO4S |
| Molecular Weight |
283.3434 |
| InChI |
InChI=1/C13H17NO4S/c1-19-8-7-11(12(15)16)14-13(17)18-9-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,14,17)(H,15,16)/t11-/m0/s1 |
| EINECS |
214-570-5 |
| Molecular Structure |
|
| Density |
1.253g/cm3 |
| Melting point |
66-70℃ |
| Boiling point |
504.7°C at 760 mmHg |
| Refractive index |
1.567 |
| Flash point |
259°C |
| Vapour Pressur |
5.22E-11mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
