1159-86-0 1,2-Dibenzoylbenzene
product Name |
1,2-Dibenzoylbenzene |
CAS No |
1159-86-0 |
Synonyms |
2-Benzoylbenzophenone; benzene-1,2-diylbis(phenylmethanone) |
Molecular Formula |
C20H14O2 |
Molecular Weight |
286.324 |
InChI |
InChI=1/C20H14O2/c21-19(15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)16-11-5-2-6-12-16/h1-14H |
EINECS |
214-597-2 |
Molecular Structure |
|
Density |
1.165g/cm3 |
Melting point |
144-147℃ |
Boiling point |
482.4°C at 760 mmHg |
Refractive index |
1.615 |
Flash point |
178.9°C |
Vapour Pressur |
1.84E-09mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
MSDS |
Material Safety Data Sheet
|
|