ChemNet > CAS > 116493-07-3 4-cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophene-2-carboxylic acid
116493-07-3 4-cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophene-2-carboxylic acid
| product Name |
4-cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophene-2-carboxylic acid |
| CAS No |
116493-07-3 |
| Synonyms |
4-cyano-3-(4-methoxyphenyl)-5-(methylsulfanyl)thiophene-2-carboxylic acid |
| Molecular Formula |
C14H11NO3S2 |
| Molecular Weight |
305.372 |
| InChI |
InChI=1/C14H11NO3S2/c1-18-9-5-3-8(4-6-9)11-10(7-15)14(19-2)20-12(11)13(16)17/h3-6H,1-2H3,(H,16,17) |
| Molecular Structure |
|
| Density |
1.43g/cm3 |
| Melting point |
209℃ |
| Boiling point |
464.9°C at 760 mmHg |
| Refractive index |
1.67 |
| Flash point |
234.9°C |
| Vapour Pressur |
1.93E-09mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
