116632-39-4 Bromoiodotoluene
product Name |
Bromoiodotoluene |
CAS No |
116632-39-4 |
Synonyms |
5-Bromo-2-iodotoluene; 4-bromo-1-iodo-2-methylbenzene |
Molecular Formula |
C7H6BrI |
Molecular Weight |
296.931 |
InChI |
InChI=1/C7H6BrI/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
Molecular Structure |
|
Density |
2.062g/cm3 |
Boiling point |
264.2°C at 760 mmHg |
Refractive index |
1.636 |
Flash point |
113.6°C |
Vapour Pressur |
0.0161mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|