ChemNet > CAS > 116668-47-4 6-Amino-2-naphthoic acid
116668-47-4 6-Amino-2-naphthoic acid
| product Name |
6-Amino-2-naphthoic acid |
| CAS No |
116668-47-4 |
| Molecular Formula |
C11H8NO2 |
| Molecular Weight |
186.1873 |
| InChI |
InChI=1/C11H9NO2/c12-10-4-3-7-5-9(11(13)14)2-1-8(7)6-10/h1-6H,12H2,(H,13,14)/p-1 |
| Molecular Structure |
|
| Melting point |
222-227℃ |
| Boiling point |
416.7°C at 760 mmHg |
| Flash point |
205.8°C |
| Vapour Pressur |
1.08E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
