ChemNet > CAS > 117-34-0 Diphenylacetic acid
117-34-0 Diphenylacetic acid
| product Name |
Diphenylacetic acid |
| CAS No |
117-34-0 |
| Synonyms |
Benzeneacetic acid, alpha-phenyl-; 2,2-Diphenylacetic Acid |
| Molecular Formula |
C14H12O2 |
| Molecular Weight |
212.2439 |
| InChI |
InChI=1/C14H12O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,15,16) |
| EINECS |
204-185-0 |
| Molecular Structure |
|
| Density |
1.174g/cm3 |
| Melting point |
147-149℃ |
| Boiling point |
285°C at 760 mmHg |
| Refractive index |
1.599 |
| Flash point |
140.4°C |
| Vapour Pressur |
0.00135mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
