117249-16-8 4-O-Benzyl-L-rhamnal
| product Name |
4-O-Benzyl-L-rhamnal |
| CAS No |
117249-16-8 |
| Synonyms |
4-O-Benzyl-6-deoxy-L-glucal; 1,5-anhydro-4-O-benzyl-2,6-dideoxy-L-arabino-hex-1-enitol |
| Molecular Formula |
C13H16O3 |
| Molecular Weight |
220.2643 |
| InChI |
InChI=1/C13H16O3/c1-10-13(12(14)7-8-15-10)16-9-11-5-3-2-4-6-11/h2-8,10,12-14H,9H2,1H3/t10-,12-,13-/m0/s1 |
| Molecular Structure |
|
| Density |
1.15g/cm3 |
| Melting point |
111℃ |
| Boiling point |
352.6°C at 760 mmHg |
| Refractive index |
1.56 |
| Flash point |
167.1°C |
| Vapour Pressur |
1.4E-05mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|