ChemNet > CAS > 117695-55-3 3,5-Dibromobenzeneboronic acid
117695-55-3 3,5-Dibromobenzeneboronic acid
| product Name |
3,5-Dibromobenzeneboronic acid |
| Synonyms |
3,5-Dibromophenylboronic acid; 3,5-dibrombenzolboronsaeure; 3,5-Dibromophenyl boronic acid |
| Molecular Formula |
C6H5BBr2O2 |
| Molecular Weight |
279.7217 |
| InChI |
InChI=1/C6H5BBr2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H |
| CAS Registry Number |
117695-55-3 |
| Molecular Structure |
|
| Density |
2.09g/cm3 |
| Melting point |
300℃ |
| Boiling point |
382.8°C at 760 mmHg |
| Refractive index |
1.651 |
| Flash point |
185.3°C |
| Vapour Pressur |
1.52E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
3,5-Dibromobenzeneboronic acid Material Safety Data Sheet
|
|
