ChemNet > CAS > 118289-17-1 2-Bromopyridine-4-carboxaldehyde
118289-17-1 2-Bromopyridine-4-carboxaldehyde
| product Name |
2-Bromopyridine-4-carboxaldehyde |
| CAS No |
118289-17-1 |
| Synonyms |
2-Bromoisonicotinaldehyde; 2-Bromo-4-pyridinecarboxaldehyde; 2-bromopyridine-4-carbaldehyde |
| Molecular Formula |
C6H4BrNO |
| Molecular Weight |
186.0061 |
| InChI |
InChI=1/C6H4BrNO/c7-6-3-5(4-9)1-2-8-6/h1-4H |
| Molecular Structure |
|
| Density |
1.683g/cm3 |
| Boiling point |
272.878°C at 760 mmHg |
| Refractive index |
1.619 |
| Flash point |
118.832°C |
| Vapour Pressur |
0.006mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
