ChemNet > CAS > 1187-34-4 ethyl N-(2-cyano-3-ethoxyacryloyl)carbamate
1187-34-4 ethyl N-(2-cyano-3-ethoxyacryloyl)carbamate
| product Name |
ethyl N-(2-cyano-3-ethoxyacryloyl)carbamate |
| CAS No |
1187-34-4 |
| Synonyms |
ethyl [(2E)-2-cyano-3-ethoxyprop-2-enoyl]carbamate |
| Molecular Formula |
C9H12N2O4 |
| Molecular Weight |
212.2026 |
| InChI |
InChI=1/C9H12N2O4/c1-3-14-6-7(5-10)8(12)11-9(13)15-4-2/h6H,3-4H2,1-2H3,(H,11,12,13)/b7-6+ |
| Molecular Structure |
|
| Density |
1.181g/cm3 |
| Melting point |
116℃ |
| Refractive index |
1.476 |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
