ChemNet > CAS > 1190-92-7 1-Dimethylamino-2-nitroethylene
1190-92-7 1-Dimethylamino-2-nitroethylene
| product Name |
1-Dimethylamino-2-nitroethylene |
| CAS No |
1190-92-7 |
| Synonyms |
1-(dimethylamino)-2-nitroethylene; (E)-N,N-dimethyl-2-nitroethenamine; 1-Nitro-2-(dimethylamino)ethylene |
| Molecular Formula |
C4H8N2O2 |
| Molecular Weight |
116.1185 |
| InChI |
InChI=1/C4H8N2O2/c1-5(2)3-4-6(7)8/h3-4H,1-2H3/b4-3+ |
| Molecular Structure |
|
| Density |
1.073g/cm3 |
| Boiling point |
161.1°C at 760 mmHg |
| Refractive index |
1.473 |
| Flash point |
51.2°C |
| Vapour Pressur |
2.31mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
