ChemNet > CAS > 1193-82-4 Methyl phenyl sulfoxide
1193-82-4 Methyl phenyl sulfoxide
| product Name |
Methyl phenyl sulfoxide |
| CAS No |
1193-82-4 |
| Synonyms |
Methyl phenyl sulphoxide; (methylsulfinyl)benzene |
| Molecular Formula |
C7H8OS |
| Molecular Weight |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-9(8)7-5-3-2-4-6-7/h2-6H,1H3 |
| EINECS |
214-781-2 |
| Molecular Structure |
|
| Density |
1.19g/cm3 |
| Melting point |
34-94℃ |
| Boiling point |
271.2°C at 760 mmHg |
| Refractive index |
1.605 |
| Flash point |
117.8°C |
| Vapour Pressur |
0.0109mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
