ChemNet > CAS > 1194-21-4 2-Amino-6-chloro-4-pyrimidinol
1194-21-4 2-Amino-6-chloro-4-pyrimidinol
| product Name |
2-Amino-6-chloro-4-pyrimidinol |
| CAS No |
1194-21-4 |
| Synonyms |
2-Amino-6-chloro-4-pyrimidinol hydrate; 2-Amino-4-chloro-6-hydroxypyrimidine; 2-amino-6-chloropyrimidin-4(3H)-one; 2-amino-6-chloropyrimidin-4-ol hydrate; 2-Amino-6-chloro-4-pyrimidinol monohydrate |
| Molecular Formula |
C4H4ClN3O |
| Molecular Weight |
145.5471 |
| InChI |
InChI=1/C4H4ClN3O/c5-2-1-3(9)8-4(6)7-2/h1H2,(H2,6,8,9) |
| EINECS |
214-785-4 |
| Molecular Structure |
|
| Density |
1.79g/cm3 |
| Melting point |
252℃ |
| Boiling point |
270.6°C at 760 mmHg |
| Refractive index |
1.717 |
| Flash point |
117.5°C |
| Vapour Pressur |
0.00676mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
