ChemNet > CAS > 1194-66-7 2,6-Dichloronitrosobenzene
1194-66-7 2,6-Dichloronitrosobenzene
| product Name |
2,6-Dichloronitrosobenzene |
| CAS No |
1194-66-7 |
| Synonyms |
1,3-dichloro-2-nitrosobenzene |
| Molecular Formula |
C6H3Cl2NO |
| Molecular Weight |
176.0001 |
| InChI |
InChI=1/C6H3Cl2NO/c7-4-2-1-3-5(8)6(4)9-10/h1-3H |
| Molecular Structure |
|
| Density |
1.45g/cm3 |
| Boiling point |
271.9°C at 760 mmHg |
| Refractive index |
1.588 |
| Flash point |
120.5°C |
| Vapour Pressur |
0.0105mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
