ChemNet > CAS > 1197-19-9 4-(Dimethylamino)benzonitrile
1197-19-9 4-(Dimethylamino)benzonitrile
| product Name |
4-(Dimethylamino)benzonitrile |
| Synonyms |
4-Dimethylaminobenzonitrile; 4-Cyano-NN-dimethylaniline |
| Molecular Formula |
C9H10N2 |
| Molecular Weight |
146.1891 |
| InChI |
InChI=1/C9H10N2/c1-11(2)9-5-3-8(7-10)4-6-9/h3-6H,1-2H3 |
| CAS Registry Number |
1197-19-9 |
| EINECS |
214-819-8 |
| Molecular Structure |
|
| Density |
1.04g/cm3 |
| Melting point |
70-76℃ |
| Boiling point |
318.8°C at 760 mmHg |
| Refractive index |
1.55 |
| Flash point |
145.4°C |
| Vapour Pressur |
0.000353mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
4-(Dimethylamino)benzonitrile Material Safety Data Sheet
|
|
