ChemNet > CAS > 1198-37-4 2,4-dimethylquinoline
1198-37-4 2,4-dimethylquinoline
| product Name |
2,4-dimethylquinoline |
| CAS No |
1198-37-4 |
| Synonyms |
Dimethylquinoline |
| Molecular Formula |
C11H11N |
| Molecular Weight |
157.2117 |
| InChI |
InChI=1/C11H11N/c1-8-7-9(2)12-11-6-4-3-5-10(8)11/h3-7H,1-2H3 |
| EINECS |
214-832-9 |
| Molecular Structure |
|
| Density |
1.052g/cm3 |
| Boiling point |
263.8°C at 760 mmHg |
| Refractive index |
1.61 |
| Flash point |
107.6°C |
| Vapour Pressur |
0.0164mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
