ChemNet > CAS > 1198-47-6 2-Amino-6-methylmercaptopurine
1198-47-6 2-Amino-6-methylmercaptopurine
| product Name |
2-Amino-6-methylmercaptopurine |
| CAS No |
1198-47-6 |
| Molecular Formula |
C6H7N5S |
| Molecular Weight |
181.2183 |
| InChI |
InChI=1/C6H7N5S/c1-12-5-3-4(9-2-8-3)10-6(7)11-5/h2-3H,1H3,(H2,7,8,9,10) |
| EINECS |
214-833-4 |
| Molecular Structure |
|
| Density |
1.78g/cm3 |
| Melting point |
234-237℃ |
| Boiling point |
344.1°C at 760 mmHg |
| Refractive index |
1.892 |
| Flash point |
161.9°C |
| Vapour Pressur |
6.74E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
