ChemNet > CAS > 120-50-3 Isobutyl benzoate
120-50-3 Isobutyl benzoate
| product Name |
Isobutyl benzoate |
| Synonyms |
Isobutyl benzoate, (Benzoic acid isobutyl ester); Benzoic acid isobutyl ester |
| Molecular Formula |
C11H14O2 |
| Molecular Weight |
178.23
|
| InChI |
InChI=1/C11H14O2/c1-9(2)8-13-11(12)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| CAS Registry Number |
120-50-3 |
| EINECS |
204-401-3 |
| Molecular Structure |
|
| Density |
0.999 |
| Boiling point |
240-242℃ |
| Refractive index |
1.493-1.495 |
| Flash point |
96℃ |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Isobutyl benzoate Material Safety Data Sheet
|
|
