ChemNet > CAS > 120-53-6 6-ethoxy-2-mercaptobenzothiazole
120-53-6 6-ethoxy-2-mercaptobenzothiazole
| product Name |
6-ethoxy-2-mercaptobenzothiazole |
| CAS No |
120-53-6 |
| Synonyms |
6-Ethoxybenzothiazolethiol; 6-ethoxy-1,3-benzothiazole-2(3H)-thione; 6-Ethoxy-Benzothiazole-2-Thiol |
| Molecular Formula |
C9H9NOS2 |
| Molecular Weight |
211.3039 |
| InChI |
InChI=1/C9H9NOS2/c1-2-11-6-3-4-7-8(5-6)13-9(12)10-7/h3-5H,2H2,1H3,(H,10,12) |
| EINECS |
204-405-5 |
| Molecular Structure |
|
| Density |
1.37g/cm3 |
| Melting point |
198-200℃ |
| Boiling point |
358.5°C at 760 mmHg |
| Refractive index |
1.698 |
| Flash point |
170.6°C |
| Vapour Pressur |
2.54E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37:Irritating to eyes and respiratory system.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
