ChemNet > CAS > 120085-62-3 4,5,7-Tri-O-acetyl-2,6-anhydro-3-deoxy-D-arabino-hept-2-enononitrile
120085-62-3 4,5,7-Tri-O-acetyl-2,6-anhydro-3-deoxy-D-arabino-hept-2-enononitrile
| product Name |
4,5,7-Tri-O-acetyl-2,6-anhydro-3-deoxy-D-arabino-hept-2-enononitrile |
| CAS No |
120085-62-3 |
| Synonyms |
(2R,3S,4R)-2-[(acetyloxy)methyl]-6-cyano-3,4-dihydro-2H-pyran-3,4-diyl diacetate (non-preferred name) |
| Molecular Formula |
C13H15NO7 |
| Molecular Weight |
297.2607 |
| InChI |
InChI=1/C13H15NO7/c1-7(15)18-6-12-13(20-9(3)17)11(19-8(2)16)4-10(5-14)21-12/h4,11-13H,6H2,1-3H3/t11-,12-,13+/m1/s1 |
| Molecular Structure |
|
| Density |
1.29g/cm3 |
| Boiling point |
397.8°C at 760 mmHg |
| Refractive index |
1.497 |
| Flash point |
174°C |
| Vapour Pressur |
1.54E-06mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|