ChemNet > CAS > 1202-25-1 Methyl 4-dimethylaminobenzoate
1202-25-1 Methyl 4-dimethylaminobenzoate
| product Name |
Methyl 4-dimethylaminobenzoate |
| CAS No |
1202-25-1 |
| Synonyms |
4-Dimethylaminobenzoic acid methyl ester |
| Molecular Formula |
C10H13NO2 |
| Molecular Weight |
179.2157 |
| InChI |
InChI=1/C10H13NO2/c1-11(2)9-6-4-8(5-7-9)10(12)13-3/h4-7H,1-3H3 |
| EINECS |
214-863-8 |
| Molecular Structure |
|
| Density |
1.084g/cm3 |
| Melting point |
100-102℃ |
| Boiling point |
280.3°C at 760 mmHg |
| Refractive index |
1.545 |
| Flash point |
112.6°C |
| Vapour Pressur |
0.00381mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
