ChemNet > CAS > 1206-15-1 1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile
1206-15-1 1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile
| product Name |
1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile |
| CAS No |
1206-15-1 |
| Synonyms |
1-(4-Methoxyphenyl)cyclopentanecarbonitrile |
| Molecular Formula |
C13H15NO |
| Molecular Weight |
201.2643 |
| InChI |
InChI=1/C13H15NO/c1-15-12-6-4-11(5-7-12)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
| EINECS |
214-890-5 |
| Molecular Structure |
|
| Density |
1.07g/cm3 |
| Boiling point |
346.4°C at 760 mmHg |
| Refractive index |
1.543 |
| Flash point |
146.2°C |
| Vapour Pressur |
5.76E-05mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
