ChemNet > CAS > 120800-52-4 6-morpholinonicotinic acid
120800-52-4 6-morpholinonicotinic acid
| product Name |
6-morpholinonicotinic acid |
| CAS No |
120800-52-4 |
| Synonyms |
6-morpholinopyridine-3-carboxylic acid |
| Molecular Formula |
C10H12N2O3 |
| Molecular Weight |
208.2139 |
| InChI |
InChI=1/C10H12N2O3/c13-10(14)8-1-2-9(11-7-8)12-3-5-15-6-4-12/h1-2,7H,3-6H2,(H,13,14) |
| Molecular Structure |
|
| Density |
1.314g/cm3 |
| Melting point |
261℃ |
| Boiling point |
446.074°C at 760 mmHg |
| Refractive index |
1.585 |
| Flash point |
223.578°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
