ChemNet > CAS > 120935-94-6 methyl 4-bromo-2,5-dimethyl-1H-pyrrole-3-carboxylate
120935-94-6 methyl 4-bromo-2,5-dimethyl-1H-pyrrole-3-carboxylate
| product Name |
methyl 4-bromo-2,5-dimethyl-1H-pyrrole-3-carboxylate |
| Molecular Formula |
C8H10BrNO2 |
| Molecular Weight |
232.0745 |
| InChI |
InChI=1/C8H10BrNO2/c1-4-6(8(11)12-3)7(9)5(2)10-4/h10H,1-3H3 |
| CAS Registry Number |
120935-94-6 |
| Molecular Structure |
|
| Density |
1.503g/cm3 |
| Boiling point |
344.5°C at 760 mmHg |
| Refractive index |
1.558 |
| Flash point |
162.2°C |
| Vapour Pressur |
6.55E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
methyl 4-bromo-2,5-dimethyl-1H-pyrrole-3-carboxylate Material Safety Data Sheet
|
|
