ChemNet > CAS > 121050-03-1 (±)-trans-Azetidine-2,4-dicarboxylic acid
121050-03-1 (±)-trans-Azetidine-2,4-dicarboxylic acid
| product Name |
(±)-trans-Azetidine-2,4-dicarboxylic acid |
| CAS No |
121050-03-1 |
| Synonyms |
(2R,4R)-azetidinium-2,4-dicarboxylate |
| Molecular Formula |
C5H6NO4 |
| Molecular Weight |
144.106 |
| InChI |
InChI=1/C5H7NO4/c7-4(8)2-1-3(6-2)5(9)10/h2-3,6H,1H2,(H,7,8)(H,9,10)/p-1/t2-,3-/m1/s1 |
| Molecular Structure |
|
| Boiling point |
352.5°C at 760 mmHg |
| Flash point |
167°C |
| Vapour Pressur |
6.48E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
