ChemNet > CAS > 1211-35-4 2-(4-chlorophenyl)-1H-indole
1211-35-4 2-(4-chlorophenyl)-1H-indole
| product Name |
2-(4-chlorophenyl)-1H-indole |
| CAS No |
1211-35-4 |
| Synonyms |
2-(4-Chlorophenyl)indole |
| Molecular Formula |
C14H10ClN |
| Molecular Weight |
227.6889 |
| InChI |
InChI=1/C14H10ClN/c15-12-7-5-10(6-8-12)14-9-11-3-1-2-4-13(11)16-14/h1-9,16H |
| Molecular Structure |
|
| Density |
1.271g/cm3 |
| Boiling point |
417.8°C at 760 mmHg |
| Refractive index |
1.684 |
| Flash point |
239°C |
| Vapour Pressur |
8.36E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
