ChemNet > CAS > 122-28-1 3-Nitroacetanilide
122-28-1 3-Nitroacetanilide
| product Name |
3-Nitroacetanilide |
| CAS No |
122-28-1 |
| Synonyms |
m-Nitroacetanilide; 3'-Nitroacetanilide; 3-Nitro-N-acetylaniline; AI3-08832; N-(3-Nitrophenyl)acetamide; N-Acetyl-m-nitroaniline; NSC 1314; Acetamide, N-(3-nitrophenyl)-; Acetanilide, 3'-nitro- (8CI) |
| Molecular Formula |
C8H8N2O3 |
| Molecular Weight |
180.1607 |
| InChI |
InChI=1/C8H8N2O3/c1-6(11)9-7-3-2-4-8(5-7)10(12)13/h2-5H,1H3,(H,9,11) |
| EINECS |
204-532-6 |
| Molecular Structure |
|
| Density |
1.34g/cm3 |
| Boiling point |
379°C at 760 mmHg |
| Refractive index |
1.617 |
| Flash point |
183°C |
| Vapour Pressur |
6.04E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
