ChemNet > CAS > 122-35-0 2-Phenoxypropionyl Chloride
122-35-0 2-Phenoxypropionyl Chloride
| product Name |
2-Phenoxypropionyl Chloride |
| CAS No |
122-35-0 |
| Synonyms |
Propanoyl chloride, 2-phenoxy-; 2-Phenoxypropionic acid chloride; 2-Phenoxypropionyl chloride; AI3-22411; NSC 9825; alpha-Phenoxypropionyl chloride; Propionyl chloride, 2-phenoxy- (8CI); 2-phenoxypropanoyl chloride |
| Molecular Formula |
C9H9ClO2 |
| Molecular Weight |
184.6196 |
| InChI |
InChI=1/C9H9ClO2/c1-7(9(10)11)12-8-5-3-2-4-6-8/h2-7H,1H3 |
| EINECS |
204-536-8 |
| Molecular Structure |
|
| Density |
1.188g/cm3 |
| Boiling point |
237.5°C at 760 mmHg |
| Refractive index |
1.517 |
| Flash point |
88.3°C |
| Vapour Pressur |
0.0447mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
